VOA: N-(6-chloropyridin-3-yl)-N~2~-(1,4-dihydro-2H-pyrano[3,4-c]quinolin-9-yl)-L-alaninamide
VOA is a Ligand Of Interest in 9DC8 designated by the Author
| Best-fitted instance in this entry |
| Other instances in this entry |
| Identifier | Ranking for goodness of fit | Ranking for geometry | Real space R factor | Real space correlation coefficient | RMSZ-bond-length | RMSZ-bond-angle | Outliers of bond length | Outliers of bond angle | Atomic clashes | Stereochemical errors | Model completeness | Average occupancy |
|---|
| 9DC8_VOA_A_802 | 100% | 41% | 0.039 | 0.987 | 0.66 | 1.62 | - | 8 | 0 | 0 | 100% | 1 |
| 9DC8_VOA_A_803 | 57% | 36% | 0.12 | 0.896 | 0.67 | 1.8 | - | 10 | 0 | 0 | 100% | 0.86 |
| 9DC8_VOA_A_804 | 28% | 40% | 0.152 | 0.803 | 0.64 | 1.65 | 1 | 7 | 2 | 0 | 100% | 0.74 |
