66T
N-{3-[2-(3,5-dimethoxyphenyl)ethyl]-1H-pyrazol-5-yl}-4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]benzamide
Find entries where: 66T
is present as a standalone ligand in 4 entries
Chemical Component Summary | |
|---|---|
| Name | N-{3-[2-(3,5-dimethoxyphenyl)ethyl]-1H-pyrazol-5-yl}-4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]benzamide |
| Identifiers | N-[3-[2-(3,5-dimethoxyphenyl)ethyl]-1H-pyrazol-5-yl]-4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]benzamide |
| Formula | C26 H33 N5 O3 |
| Molecular Weight | 463.572 |
| Type | NON-POLYMER |
| Isomeric SMILES | C[C@@H]1CN(C[C@@H](N1)C)c2ccc(cc2)C(=O)Nc3cc(n[nH]3)CCc4cc(cc(c4)OC)OC |
| InChI | InChI=1S/C26H33N5O3/c1-17-15-31(16-18(2)27-17)22-9-6-20(7-10-22)26(32)28-25-13-21(29-30-25)8-5-19-11-23(33-3)14-24(12-19)34-4/h6-7,9-14,17-18,27H,5,8,15-16H2,1-4H3,(H2,28,29,30,32)/t17-,18+ |
| InChIKey | VRQMAABPASPXMW-HDICACEKSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 67 |
| Chiral Atom Count | 2 |
| Bond Count | 70 |
| Aromatic Bond Count | 17 |
Drug Info: DrugBank
| DrugBank ID | DB12247 |
|---|---|
| Name | AZD-4547 |
| Groups | investigational |
| Description | AZD4547 has been used in trials studying the treatment of Cancer, LYMPHOMA, Gastric Cancer, Adenocarcinoma, and Solid Neoplasm, among others. |
| Synonyms | AZD-4547 |
| CAS number | 1035270-39-3 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL3348846 |
| PubChem | 51039095 |
| ChEMBL | CHEMBL3348846 |
| ChEBI | CHEBI:63453 |
