Chemical Component Summary | |
|---|---|
| Name | methopterin |
| Synonyms | N-(4-{[(2-amino-4-oxo-3,4-dihydropteridin-6-yl)methyl](methyl)amino}benzoyl)-L-glutamic acid; 10-methylfolic acid |
| Identifiers | (2~{S})-2-[[4-[(2-azanyl-4-oxidanylidene-3~{H}-pteridin-6-yl)methyl-methyl-amino]phenyl]carbonylamino]pentanedioic acid |
| Formula | C20 H21 N7 O6 |
| Molecular Weight | 455.424 |
| Type | NON-POLYMER |
| Isomeric SMILES | CN(Cc1cnc2c(n1)C(=O)NC(=N2)N)c3ccc(cc3)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H21N7O6/c1-27(9-11-8-22-16-15(23-11)18(31)26-20(21)25-16)12-4-2-10(3-5-12)17(30)24-13(19(32)33)6-7-14(28)29/h2-5,8,13H,6-7,9H2,1H3,(H,24,30)(H,28,29)(H,32,33)(H3,21,22,25,26,31)/t13-/m0/s1 |
| InChIKey | HLIXOCXUWGDBNP-ZDUSSCGKSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 54 |
| Chiral Atom Count | 1 |
| Bond Count | 56 |
| Aromatic Bond Count | 12 |
Drug Info: DrugBank
| DrugBank ID | DB16620 |
|---|---|
| Name | Methopterin |
| Groups | investigational |
| Description | Methopterin is thought to have effects on osteoclasts and to inhibit inflammatory bone destruction.[A229843] |
| Synonyms |
|
| CAS number | 2410-93-7 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL158990 |
| PubChem | 92929, 135434845 |
| ChEMBL | CHEMBL158990 |
| ChEBI | CHEBI:183928 |
