AH4
2-(diphenylamino)-N-[7-(hydroxyamino)-7-oxoheptyl]pyrimidine-5-carboxamide
Find entries where: AH4
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | 2-(diphenylamino)-N-[7-(hydroxyamino)-7-oxoheptyl]pyrimidine-5-carboxamide |
| Identifiers | 2-(diphenylamino)-~{N}-[7-(oxidanylamino)-7-oxidanylidene-heptyl]pyrimidine-5-carboxamide |
| Formula | C24 H27 N5 O3 |
| Molecular Weight | 433.503 |
| Type | NON-POLYMER |
| Isomeric SMILES | c1ccc(cc1)N(c2ccccc2)c3ncc(cn3)C(=O)NCCCCCCC(=O)NO |
| InChI | InChI=1S/C24H27N5O3/c30-22(28-32)15-9-1-2-10-16-25-23(31)19-17-26-24(27-18-19)29(20-11-5-3-6-12-20)21-13-7-4-8-14-21/h3-8,11-14,17-18,32H,1-2,9-10,15-16H2,(H,25,31)(H,28,30) |
| InChIKey | QGZYDVAGYRLSKP-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 59 |
| Chiral Atom Count | 0 |
| Bond Count | 61 |
| Aromatic Bond Count | 18 |
Drug Info: DrugBank
| DrugBank ID | DB12376 |
|---|---|
| Name | Ricolinostat |
| Groups | investigational |
| Description | Ricolinostat is under investigation for the treatment of Breast Carcinoma and Metastatic Breast Cancer. |
| Synonyms | Ricolinostat |
| Categories |
|
| CAS number | 1316214-52-4 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL2364628 |
| PubChem | 53340666 |
| ChEMBL | CHEMBL2364628 |
| ChEBI | CHEBI:95073 |
