EWR
(2S)-2-ethoxy-3-[4-[2-[2-methyl-5-(4-methylsulfanylphenyl)pyrrol-1-yl]ethoxy]phenyl]propanoic acid
Find entries where: EWR
is present as a standalone ligand in 3 entries
Chemical Component Summary | |
|---|---|
| Name | (2S)-2-ethoxy-3-[4-[2-[2-methyl-5-(4-methylsulfanylphenyl)pyrrol-1-yl]ethoxy]phenyl]propanoic acid |
| Identifiers | (2~{S})-2-ethoxy-3-[4-[2-[2-methyl-5-(4-methylsulfanylphenyl)pyrrol-1-yl]ethoxy]phenyl]propanoic acid |
| Formula | C25 H29 N O4 S |
| Molecular Weight | 439.567 |
| Type | NON-POLYMER |
| Isomeric SMILES | CCO[C@@H](Cc1ccc(cc1)OCCn2c(ccc2c3ccc(cc3)SC)C)C(=O)O |
| InChI | InChI=1S/C25H29NO4S/c1-4-29-24(25(27)28)17-19-6-10-21(11-7-19)30-16-15-26-18(2)5-14-23(26)20-8-12-22(31-3)13-9-20/h5-14,24H,4,15-17H2,1-3H3,(H,27,28)/t24-/m0/s1 |
| InChIKey | MRWFZSLZNUJVQW-DEOSSOPVSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 60 |
| Chiral Atom Count | 1 |
| Bond Count | 62 |
| Aromatic Bond Count | 17 |
Drug Info: DrugBank
| DrugBank ID | DB13115 |
|---|---|
| Name | Saroglitazar |
| Groups | investigational |
| Description | Saroglitazar has been investigated for the treatment of Fatty Liver. |
| Synonyms |
|
| Categories | Acids, Carbocyclic |
| CAS number | 495399-09-2 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL4297530 |
| PubChem | 60151560 |
| ChEMBL | CHEMBL4297530 |
| ChEBI | CHEBI:134708 |
