H6N
Protocatechuic aldehyde
| Created: | 2018-11-18 |
| Last modified: | 2024-09-27 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 16 |
| Chiral Atom Count | 0 |
| Bond Count | 16 |
| Aromatic Bond Count | 6 |
Chemical Component Summary | |
|---|---|
| Name | Protocatechuic aldehyde |
| Systematic Name (OpenEye OEToolkits) | 3,4-bis(oxidanyl)benzaldehyde |
| Formula | C7 H6 O3 |
| Molecular Weight | 138.121 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | CACTVS | 3.385 | Oc1ccc(C=O)cc1O |
| SMILES | OpenEye OEToolkits | 2.0.6 | c1cc(c(cc1C=O)O)O |
| Canonical SMILES | CACTVS | 3.385 | Oc1ccc(C=O)cc1O |
| Canonical SMILES | OpenEye OEToolkits | 2.0.6 | c1cc(c(cc1C=O)O)O |
| InChI | InChI | 1.03 | InChI=1S/C7H6O3/c8-4-5-1-2-6(9)7(10)3-5/h1-4,9-10H |
| InChIKey | InChI | 1.03 | IBGBGRVKPALMCQ-UHFFFAOYSA-N |
Drug Info: DrugBank
| DrugBank ID | DB11268 |
|---|---|
| Name | Protocatechualdehyde |
| Groups | experimental |
| Description | Also known as protocatechuic aldehyde, protocatechualdehyde is a naturally-occuring phenolic aldehyde that is found in barley, green cavendish bananas, grapevine leaves and root of the herb S. miltiorrhiza [A27224]. Protocatechualdehyde possesses antiproliferative and pro-apoptotic properties against human breast cancer cells and colorectal cancer cells by reducing the expression of pro-oncogenes β-catenin and cyclin D1. |
| Synonyms |
|
| Brand Names | O Hui White Extreme Cellight |
| Categories |
|
| CAS number | 139-85-5 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 8768 |
| ChEMBL | CHEMBL222021 |
| ChEBI | CHEBI:50205 |
| CCDC/CSD | MASBUD, AWIVAG |
| COD | 7213183 |
