ML9
2-amino-8-[trans-4-(2-hydroxyethoxy)cyclohexyl]-6-(6-methoxypyridin-3-yl)-4-methylpyrido[2,3-d]pyrimidin-7(8H)-one
Find entries where: ML9
is present as a standalone ligand in 2 entries
Chemical Component Summary | |
|---|---|
| Name | 2-amino-8-[trans-4-(2-hydroxyethoxy)cyclohexyl]-6-(6-methoxypyridin-3-yl)-4-methylpyrido[2,3-d]pyrimidin-7(8H)-one |
| Identifiers | 2-azanyl-8-[4-(2-hydroxyethoxy)cyclohexyl]-6-(6-methoxypyridin-3-yl)-4-methyl-pyrido[2,3-d]pyrimidin-7-one |
| Formula | C22 H27 N5 O4 |
| Molecular Weight | 425.481 |
| Type | NON-POLYMER |
| Isomeric SMILES | Cc1c2c(nc(n1)N)N(C(=O)C(=C2)c3ccc(nc3)OC)C4CCC(CC4)OCCO |
| InChI | InChI=1S/C22H27N5O4/c1-13-17-11-18(14-3-8-19(30-2)24-12-14)21(29)27(20(17)26-22(23)25-13)15-4-6-16(7-5-15)31-10-9-28/h3,8,11-12,15-16,28H,4-7,9-10H2,1-2H3,(H2,23,25,26)/t15-,16- |
| InChIKey | XDLYKKIQACFMJG-WKILWMFISA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 58 |
| Chiral Atom Count | 0 |
| Bond Count | 61 |
| Aromatic Bond Count | 12 |
Drug Info: DrugBank
| DrugBank ID | DB11974 |
|---|---|
| Name | PF-04691502 |
| Groups | investigational |
| Description | PF-04691502 has been used in trials studying the treatment of Cancer, Breast Neoplasms, Early Breast Cancer (Phase 2), and Advanced Breast Cancer (Phase 1b). |
| Synonyms | PF-04691502 |
| Categories |
|
| CAS number | 1013101-36-4 |
