Chemical Component Summary | |
|---|---|
| Name | Resminostat |
| Synonyms | (2E)-3-[1-({4-[(dimethylamino)methyl]phenyl}sulfonyl)-1H-pyrrol-3-yl]-N-hydroxyprop-2-enamide |
| Identifiers | (~{E})-3-[1-[4-[(dimethylamino)methyl]phenyl]sulfonylpyrrol-3-yl]-~{N}-oxidanyl-prop-2-enamide |
| Formula | C16 H19 N3 O4 S |
| Molecular Weight | 349.405 |
| Type | NON-POLYMER |
| Isomeric SMILES | CN(C)Cc1ccc(cc1)S(=O)(=O)n2ccc(c2)/C=C/C(=O)NO |
| InChI | InChI=1S/C16H19N3O4S/c1-18(2)11-13-3-6-15(7-4-13)24(22,23)19-10-9-14(12-19)5-8-16(20)17-21/h3-10,12,21H,11H2,1-2H3,(H,17,20)/b8-5+ |
| InChIKey | FECGNJPYVFEKOD-VMPITWQZSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 43 |
| Chiral Atom Count | 0 |
| Bond Count | 44 |
| Aromatic Bond Count | 11 |
Drug Info: DrugBank
| DrugBank ID | DB12392 |
|---|---|
| Name | Resminostat |
| Groups | investigational |
| Description | Resminostat has been used in trials studying the treatment of Sezary Syndrome, Mycosis fungoides, Hodgkin's Lymphoma, Hepatocellular Carcinoma, and Lymphoma, T-Cell, Cutaneous, among others. |
| Synonyms | Resminostat |
| Categories |
|
| CAS number | 864814-88-0 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL4296717 |
| PubChem | 11609955 |
| ChEMBL | CHEMBL4296717 |
