PT6
1-(3-amino-2-methylbenzyl)-4-[2-(thiophen-2-yl)ethoxy]pyridin-2(1H)-one
Find entries where: PT6
is present as a standalone ligand in 3 entries
Chemical Component Summary | |
|---|---|
| Name | 1-(3-amino-2-methylbenzyl)-4-[2-(thiophen-2-yl)ethoxy]pyridin-2(1H)-one |
| Identifiers | 1-[(3-azanyl-2-methyl-phenyl)methyl]-4-(2-thiophen-2-ylethoxy)pyridin-2-one |
| Formula | C19 H20 N2 O2 S |
| Molecular Weight | 340.439 |
| Type | NON-POLYMER |
| Isomeric SMILES | Cc1c(cccc1N)CN2C=CC(=CC2=O)OCCc3cccs3 |
| InChI | InChI=1S/C19H20N2O2S/c1-14-15(4-2-6-18(14)20)13-21-9-7-16(12-19(21)22)23-10-8-17-5-3-11-24-17/h2-7,9,11-12H,8,10,13,20H2,1H3 |
| InChIKey | YCLREGRRHGLOAK-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 44 |
| Chiral Atom Count | 0 |
| Bond Count | 46 |
| Aromatic Bond Count | 11 |
Drug Info: DrugBank
| DrugBank ID | DB12347 |
|---|---|
| Name | CG-400549 |
| Groups | investigational |
| Description | CG400549 has been used in trials studying the treatment of Skin Infection. |
| Synonyms | CG-400549 |
| Categories | Sulfur Compounds |
| CAS number | 934628-27-0 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 11844916 |
| ChEMBL | CHEMBL488937 |
