27A
(Z)-2-[2-(4-methylpiperazin-1-yl)benzyl]diazenecarbothioamide
Find entries where: 27A
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | (Z)-2-[2-(4-methylpiperazin-1-yl)benzyl]diazenecarbothioamide |
| Identifiers | (Z)-[2-(4-methylpiperazin-1-yl)phenyl]methyliminothiourea |
| Formula | C13 H19 N5 S |
| Molecular Weight | 277.388 |
| Type | NON-POLYMER |
| Isomeric SMILES | CN1CCN(CC1)c2ccccc2C/N=N\C(=S)N |
| InChI | InChI=1S/C13H19N5S/c1-17-6-8-18(9-7-17)12-5-3-2-4-11(12)10-15-16-13(14)19/h2-5H,6-10H2,1H3,(H2,14,19)/b16-15- |
| InChIKey | KAASZVAHBVMHCO-NXVVXOECSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 38 |
| Chiral Atom Count | 0 |
| Bond Count | 39 |
| Aromatic Bond Count | 6 |
Drug Info: DrugBank
| DrugBank ID | DB06941 |
|---|---|
| Name | (Z)-2-[2-(4-methylpiperazin-1-yl)benzyl]diazenecarbothioamide |
| Groups | experimental |
| Description | (Z)-2-[2-(4-methylpiperazin-1-yl)benzyl]diazenecarbothioamide is a solid. This compound belongs to the phenylpiperazines. These are compounds containing a phenylpiperazine skeleton, which consists of a piperazine bound to a phenyl group. This drug targets the protein S100B. |
| Synonyms | (Z)-2-[2-(4-methylpiperazin-1-yl)benzyl]diazenecarbothioamide |
Drug Targets
| Name | Target Sequence | Pharmacological Action | Actions |
|---|---|---|---|
| Protein S100-B | MSELEKAMVALIDVFHQYSGREGDKHKLKKSELKELINNELSHFLEEIKE... | unknown |
Drug Info/Drug Targets: DrugBank 3.0: a comprehensive resource for 'omics' research on drugs. Knox C, Law V, Jewison
T, Liu P, Ly S, Frolkis A, Pon A, Banco K, Mak C, Neveu V, Djoumbou Y, Eisner R, Guo AC, Wishart DS.
Nucleic Acids Res. 2011 Jan; 39 (Database issue):D1035-41. | PMID:21059682
