Chemical Component Summary | |
|---|---|
| Name | TAK-715 |
| Synonyms | N-{4-[2-ETHYL-4-(3-METHYLPHENYL)-1,3-THIAZOL-5-YL]PYRIDIN-2-YL}BENZAMIDE |
| Identifiers | N-[4-[2-ethyl-4-(3-methylphenyl)-1,3-thiazol-5-yl]pyridin-2-yl]benzamide |
| Formula | C24 H21 N3 O S |
| Molecular Weight | 399.508 |
| Type | NON-POLYMER |
| Isomeric SMILES | CCc1nc(c(s1)c2ccnc(c2)NC(=O)c3ccccc3)c4cccc(c4)C |
| InChI | InChI=1S/C24H21N3OS/c1-3-21-27-22(18-11-7-8-16(2)14-18)23(29-21)19-12-13-25-20(15-19)26-24(28)17-9-5-4-6-10-17/h4-15H,3H2,1-2H3,(H,25,26,28) |
| InChIKey | HEKAIDKUDLCBRU-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 50 |
| Chiral Atom Count | 0 |
| Bond Count | 53 |
| Aromatic Bond Count | 23 |
Drug Info: DrugBank
| DrugBank ID | DB16108 |
|---|---|
| Name | TAK-715 |
| Groups | investigational |
| Description | TAK-715 is under investigation in clinical trial NCT00760864 (Safety and Efficacy of TAK-715 in Subjects With Rheumatoid Arthritis). |
| Synonyms | TAK-715 |
| Categories |
|
| CAS number | 303162-79-0 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL363648 |
| PubChem | 9952773 |
| ChEMBL | CHEMBL363648 |
| ChEBI | CHEBI:91360 |
